C5H14N6 — CID 4639692
1-N',5-N'-diaminopentanediimidamide (PubChem CID 4639692) has the molecular formula C5H14N6 and a molecular weight of 158.21 g/mol. Its IUPAC name is 1-N',5-N'-diaminopentanediimidamide.
| Compound Name | 1-N',5-N'-diaminopentanediimidamide |
|---|---|
| PubChem CID | 4639692 |
| Molecular Formula | C5H14N6 |
| Molecular Weight | 158.21 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 1-N',5-N'-diaminopentanediimidamide |
| SMILES | NN=C(N)CCCC(N)=NN |
| InChI | InChI=1S/C5H14N6/c6-4(10-8)2-1-3-5(7)11-9/h1-3,8-9H2,(H2,6,10)(H2,7,11) |
| InChIKey | ZQSNQFZEHUOCPW-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.21 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|