C18H26O — CID 155599989
(2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethenylpenta-2,4-dien-1-one;ethane (PubChem CID 155599989) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethenylpenta-2,4-dien-1-one;ethane.
| Compound Name | (2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethenylpenta-2,4-dien-1-one;ethane |
|---|---|
| PubChem CID | 155599989 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethenylpenta-2,4-dien-1-one;ethane |
| SMILES | C=C/C=C(\C=C)C(=O)C1=CC=CCC=C1.CC.CC |
| InChI | InChI=1S/C14H14O.2C2H6/c1-3-9-12(4-2)14(15)13-10-7-5-6-8-11-13;2*1-2/h3-5,7-11H,1-2,6H2;2*1-2H3/b12-9+;; |
| InChIKey | KOEAQPFIDOMECF-ANOGCNOSSA-N |
| XLogP | 5.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|