C16H18O2 — CID 144963288
(4Z,6E)-6-cyclohepta-1,3,6-trien-1-yloxynona-4,6,8-trien-2-one (PubChem CID 144963288) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (4Z,6E)-6-cyclohepta-1,3,6-trien-1-yloxynona-4,6,8-trien-2-one.
| Compound Name | (4Z,6E)-6-cyclohepta-1,3,6-trien-1-yloxynona-4,6,8-trien-2-one |
|---|---|
| PubChem CID | 144963288 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (4Z,6E)-6-cyclohepta-1,3,6-trien-1-yloxynona-4,6,8-trien-2-one |
| SMILES | C=C/C=C(\C=C/CC(C)=O)OC1=CC=CCC=C1 |
| InChI | InChI=1S/C16H18O2/c1-3-9-15(13-8-10-14(2)17)18-16-11-6-4-5-7-12-16/h3-4,6-9,11-13H,1,5,10H2,2H3/b13-8-,15-9+ |
| InChIKey | YBHJIYDXWZREGD-LHHRFCNSSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|