About cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate
cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate (PubChem CID 143215941) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate.
Molecular Properties
| Compound Name | cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate |
| PubChem CID | 143215941 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate |
| SMILES | CC(C)c1cc(NCC(=O)OC2=CC=CCC=C2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H23N3O2/c1-16(2)19-14-20(24(23-19)17-10-6-5-7-11-17)22-15-21(25)26-18-12-8-3-4-9-13-18/h3,5-14,16,22H,4,15H2,1-2H3 |
| InChIKey | OYPQYAJARGTAAA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate?
The IUPAC name of cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate (CID 143215941) is cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate.
What is the SMILES notation for cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate?
The canonical SMILES for cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate is CC(C)c1cc(NCC(=O)OC2=CC=CCC=C2)n(-c2ccccc2)n1.
What is the InChIKey of cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate?
The InChIKey is OYPQYAJARGTAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-16(2)19-14-20(24(23-19)17-10-6-5-7-11-17)22-15-21(25)26-18-12-8-3-4-9-13-18/h3,5-14,16,22H,4,15H2,1-2H3.
What are the key properties of cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate?
cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate has a molecular weight of 349.43 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta-1,3,6-trien-1-yl 2-[(1-phenyl-3-propan-2-ylpyrazol-5-yl)amino]acetate is sourced from PubChem (CID 143215941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).