C18H22O2 — CID 142194063
4-cyclohepta-1,3,6-trien-1-yloxy-2-prop-2-enylphenol;ethane (PubChem CID 142194063) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-cyclohepta-1,3,6-trien-1-yloxy-2-prop-2-enylphenol;ethane.
| Compound Name | 4-cyclohepta-1,3,6-trien-1-yloxy-2-prop-2-enylphenol;ethane |
|---|---|
| PubChem CID | 142194063 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-cyclohepta-1,3,6-trien-1-yloxy-2-prop-2-enylphenol;ethane |
| SMILES | C=CCc1cc(OC2=CC=CCC=C2)ccc1O.CC |
| InChI | InChI=1S/C16H16O2.C2H6/c1-2-7-13-12-15(10-11-16(13)17)18-14-8-5-3-4-6-9-14;1-2/h2-3,5-6,8-12,17H,1,4,7H2;1-2H3 |
| InChIKey | GINRTUPJCIHTKA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|