C15H19NO — CID 118292910
amino-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanol (PubChem CID 118292910) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is amino-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanol.
| Compound Name | amino-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanol |
|---|---|
| PubChem CID | 118292910 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | amino-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanol |
| SMILES | CC1(C)C=CC(C(N)(O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C15H19NO/c1-14(2)10-8-13(9-11-14)15(16,17)12-6-4-3-5-7-12/h3-10,17H,11,16H2,1-2H3 |
| InChIKey | VDEHOYVBFCDQHE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|