C16H25NOS — CID 107271988
1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-phenylpropan-2-ol (PubChem CID 107271988) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-phenylpropan-2-ol.
| Compound Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 107271988 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-phenylpropan-2-ol |
| SMILES | CC1(C)CCN(CC(C)(O)c2ccccc2)CCS1 |
| InChI | InChI=1S/C16H25NOS/c1-15(2)9-10-17(11-12-19-15)13-16(3,18)14-7-5-4-6-8-14/h4-8,18H,9-13H2,1-3H3 |
| InChIKey | DNNDNFMDQUXJDF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |