C14H27NOS — CID 107459304
2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methylpentanal (PubChem CID 107459304) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methylpentanal.
| Compound Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methylpentanal |
|---|---|
| PubChem CID | 107459304 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methylpentanal |
| SMILES | CCCC(C)(C=O)CN1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C14H27NOS/c1-5-6-14(4,12-16)11-15-8-7-13(2,3)17-10-9-15/h12H,5-11H2,1-4H3 |
| InChIKey | TVCNEEPINIVTBG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|