C11H21NO3S — CID 62277156
2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylpentanal (PubChem CID 62277156) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylpentanal.
| Compound Name | 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylpentanal |
|---|---|
| PubChem CID | 62277156 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylpentanal |
| SMILES | CCCC(C)(C=O)CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H21NO3S/c1-3-4-11(2,10-13)9-12-5-7-16(14,15)8-6-12/h10H,3-9H2,1-2H3 |
| InChIKey | XJSIHMDERJOYHN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|