C10H19NOS — CID 107456887
3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanal (PubChem CID 107456887) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanal.
| Compound Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanal |
|---|---|
| PubChem CID | 107456887 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanal |
| SMILES | CC1(C)CCN(CCC=O)CCS1 |
| InChI | InChI=1S/C10H19NOS/c1-10(2)4-6-11(5-3-8-12)7-9-13-10/h8H,3-7,9H2,1-2H3 |
| InChIKey | DZFNRNMFRRLVFC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|