C13H26BrNS — CID 107458346
4-(5-bromo-3-methylpentyl)-7,7-dimethyl-1,4-thiazepane (PubChem CID 107458346) has the molecular formula C13H26BrNS and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-(5-bromo-3-methylpentyl)-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-(5-bromo-3-methylpentyl)-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107458346 |
| Molecular Formula | C13H26BrNS |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-(5-bromo-3-methylpentyl)-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC(CCBr)CCN1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C13H26BrNS/c1-12(4-7-14)5-8-15-9-6-13(2,3)16-11-10-15/h12H,4-11H2,1-3H3 |
| InChIKey | PBVXYXZNRDBDHQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|