C9H18FNS — CID 130739897
4-(2-fluoroethyl)-7,7-dimethyl-1,4-thiazepane (PubChem CID 130739897) has the molecular formula C9H18FNS and a molecular weight of 191.31 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-(2-fluoroethyl)-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 130739897 |
| Molecular Formula | C9H18FNS |
| Molecular Weight | 191.31 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-(2-fluoroethyl)-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(CCF)CCS1 |
| InChI | InChI=1S/C9H18FNS/c1-9(2)3-5-11(6-4-10)7-8-12-9/h3-8H2,1-2H3 |
| InChIKey | PWGLZRUWUDYTFR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |