C11H21NO2S — CID 107456463
methyl 3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoate (PubChem CID 107456463) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is methyl 3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoate.
| Compound Name | methyl 3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoate |
|---|---|
| PubChem CID | 107456463 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl 3-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoate |
| SMILES | COC(=O)CCN1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C11H21NO2S/c1-11(2)5-7-12(8-9-15-11)6-4-10(13)14-3/h4-9H2,1-3H3 |
| InChIKey | RXYXLMCBMGJNAT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |