C9H18N2OS — CID 107271958
2-(7,7-dimethyl-1,4-thiazepan-4-yl)acetamide (PubChem CID 107271958) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 2-(7,7-dimethyl-1,4-thiazepan-4-yl)acetamide.
| Compound Name | 2-(7,7-dimethyl-1,4-thiazepan-4-yl)acetamide |
|---|---|
| PubChem CID | 107271958 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(7,7-dimethyl-1,4-thiazepan-4-yl)acetamide |
| SMILES | CC1(C)CCN(CC(N)=O)CCS1 |
| InChI | InChI=1S/C9H18N2OS/c1-9(2)3-4-11(5-6-13-9)7-8(10)12/h3-7H2,1-2H3,(H2,10,12) |
| InChIKey | UDZXTSKQNUDVQH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |