C13H23NO2S — CID 107456456
4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethylbut-2-enoic acid (PubChem CID 107456456) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethylbut-2-enoic acid.
| Compound Name | 4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 107456456 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCN1CCSC(C)(C)CC1)C(=O)O |
| InChI | InChI=1S/C13H23NO2S/c1-4-11(12(15)16)5-7-14-8-6-13(2,3)17-10-9-14/h5H,4,6-10H2,1-3H3,(H,15,16) |
| InChIKey | QKUYAUZCCXUZKT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|