C14H25NO3S — CID 107456942
ethyl 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-oxopentanoate (PubChem CID 107456942) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is ethyl 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-oxopentanoate.
| Compound Name | ethyl 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-oxopentanoate |
|---|---|
| PubChem CID | 107456942 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)CN1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C14H25NO3S/c1-4-18-13(17)6-5-12(16)11-15-8-7-14(2,3)19-10-9-15/h4-11H2,1-3H3 |
| InChIKey | KGRTZVGTHGGSEB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |