C13H27N3OS — CID 107455407
4-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 107455407) has the molecular formula C13H27N3OS and a molecular weight of 273.45 g/mol. Its IUPAC name is 4-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 107455407 |
| Molecular Formula | C13H27N3OS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 4-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC1(C)CCN(CCC(C)(C)C(N)=NO)CCS1 |
| InChI | InChI=1S/C13H27N3OS/c1-12(2,11(14)15-17)5-7-16-8-6-13(3,4)18-10-9-16/h17H,5-10H2,1-4H3,(H2,14,15) |
| InChIKey | HTBKTGIKYSLNMK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|