C12H22BrNS — CID 107458344
4-[[1-(bromomethyl)cyclopropyl]methyl]-7,7-dimethyl-1,4-thiazepane (PubChem CID 107458344) has the molecular formula C12H22BrNS and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[[1-(bromomethyl)cyclopropyl]methyl]-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-[[1-(bromomethyl)cyclopropyl]methyl]-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107458344 |
| Molecular Formula | C12H22BrNS |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-[[1-(bromomethyl)cyclopropyl]methyl]-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(CC2(CBr)CC2)CCS1 |
| InChI | InChI=1S/C12H22BrNS/c1-11(2)5-6-14(7-8-15-11)10-12(9-13)3-4-12/h3-10H2,1-2H3 |
| InChIKey | AJTUEIFHYWIHSN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|