C13H24BrN — CID 65283132
1-[[1-(bromomethyl)cyclopropyl]methyl]-4,4-dimethylazepane (PubChem CID 65283132) has the molecular formula C13H24BrN and a molecular weight of 274.25 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cyclopropyl]methyl]-4,4-dimethylazepane.
| Compound Name | 1-[[1-(bromomethyl)cyclopropyl]methyl]-4,4-dimethylazepane |
|---|---|
| PubChem CID | 65283132 |
| Molecular Formula | C13H24BrN |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-[[1-(bromomethyl)cyclopropyl]methyl]-4,4-dimethylazepane |
| SMILES | CC1(C)CCCN(CC2(CBr)CC2)CC1 |
| InChI | InChI=1S/C13H24BrN/c1-12(2)4-3-8-15(9-7-12)11-13(10-14)5-6-13/h3-11H2,1-2H3 |
| InChIKey | ZSBBIJYTZMHUIZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|