C8H14N2O4S2 — CID 164573208
4-N,4-dimethylcyclohexa-1,5-diene-1,4-disulfonamide (PubChem CID 164573208) has the molecular formula C8H14N2O4S2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-N,4-dimethylcyclohexa-1,5-diene-1,4-disulfonamide.
| Compound Name | 4-N,4-dimethylcyclohexa-1,5-diene-1,4-disulfonamide |
|---|---|
| PubChem CID | 164573208 |
| Molecular Formula | C8H14N2O4S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4-N,4-dimethylcyclohexa-1,5-diene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)C1(C)C=CC(S(N)(=O)=O)=CC1 |
| InChI | InChI=1S/C8H14N2O4S2/c1-8(16(13,14)10-2)5-3-7(4-6-8)15(9,11)12/h3-5,10H,6H2,1-2H3,(H2,9,11,12) |
| InChIKey | OCWGGTKNGVULKO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |