C20H16N2O7S2 — CID 87198952
2-hydroxy-1-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid (PubChem CID 87198952) has the molecular formula C20H16N2O7S2 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-hydroxy-1-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid.
| Compound Name | 2-hydroxy-1-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 87198952 |
| Molecular Formula | C20H16N2O7S2 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-hydroxy-1-(naphthalen-1-yldiazenyl)naphthalene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)C1(O)C=Cc2ccccc2C1(/N=N/c1cccc2ccccc12)S(=O)(=O)O |
| InChI | InChI=1S/C20H16N2O7S2/c23-19(30(24,25)26)13-12-15-7-2-4-10-17(15)20(19,31(27,28)29)22-21-18-11-5-8-14-6-1-3-9-16(14)18/h1-13,23H,(H,24,25,26)(H,27,28,29)/b22-21+ |
| InChIKey | JRYKGPHTUZXUOJ-QURGRASLSA-N |
| XLogP | 3.27 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|