C22H18N4O7S2 — CID 87198798
2-hydroxy-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,2-disulfonic acid (PubChem CID 87198798) has the molecular formula C22H18N4O7S2 and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-hydroxy-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,2-disulfonic acid.
| Compound Name | 2-hydroxy-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 87198798 |
| Molecular Formula | C22H18N4O7S2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 2-hydroxy-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)C1(O)C=Cc2ccccc2C1(/N=N/c1ccc(/N=N/c2ccccc2)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C22H18N4O7S2/c27-21(34(28,29)30)15-14-16-6-4-5-9-20(16)22(21,35(31,32)33)26-25-19-12-10-18(11-13-19)24-23-17-7-2-1-3-8-17/h1-15,27H,(H,28,29,30)(H,31,32,33)/b24-23+,26-25+ |
| InChIKey | HELBJVYNBIXRMJ-QSZPNPOGSA-N |
| XLogP | 4.53 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|