C7H4Cl2F3NO2 — CID 139643970
3,5-dichloro-5-nitro-2-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 139643970) has the molecular formula C7H4Cl2F3NO2 and a molecular weight of 262.01 g/mol. Its IUPAC name is 3,5-dichloro-5-nitro-2-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 3,5-dichloro-5-nitro-2-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139643970 |
| Molecular Formula | C7H4Cl2F3NO2 |
| Molecular Weight | 262.01 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 3,5-dichloro-5-nitro-2-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1(Cl)C=C(Cl)C(C(F)(F)F)=CC1 |
| InChI | InChI=1S/C7H4Cl2F3NO2/c8-5-3-6(9,13(14)15)2-1-4(5)7(10,11)12/h1,3H,2H2 |
| InChIKey | ZCOQVJZWESASEA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.01 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|