C6H5Cl2NO3 — CID 70602323
4,5-dichloro-4-nitrocyclohexa-1,5-dien-1-ol (PubChem CID 70602323) has the molecular formula C6H5Cl2NO3 and a molecular weight of 210.02 g/mol. Its IUPAC name is 4,5-dichloro-4-nitrocyclohexa-1,5-dien-1-ol.
| Compound Name | 4,5-dichloro-4-nitrocyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 70602323 |
| Molecular Formula | C6H5Cl2NO3 |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 208.96 |
| IUPAC Name | 4,5-dichloro-4-nitrocyclohexa-1,5-dien-1-ol |
| SMILES | O=[N+]([O-])C1(Cl)CC=C(O)C=C1Cl |
| InChI | InChI=1S/C6H5Cl2NO3/c7-5-3-4(10)1-2-6(5,8)9(11)12/h1,3,10H,2H2 |
| InChIKey | SCIMURIIUPEDEE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|