C9H10O3 — CID 21416083
2,5-dihydrochromene-4a,7-diol (PubChem CID 21416083) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,5-dihydrochromene-4a,7-diol.
| Compound Name | 2,5-dihydrochromene-4a,7-diol |
|---|---|
| PubChem CID | 21416083 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2,5-dihydrochromene-4a,7-diol |
| SMILES | OC1=CCC2(O)C=CCOC2=C1 |
| InChI | InChI=1S/C9H10O3/c10-7-2-4-9(11)3-1-5-12-8(9)6-7/h1-3,6,10-11H,4-5H2 |
| InChIKey | DLKWYNWFYNNODM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|