C8H12O2 — CID 163590235
6,6-dimethylcyclohexa-1,3-diene-1,3-diol (PubChem CID 163590235) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 6,6-dimethylcyclohexa-1,3-diene-1,3-diol.
| Compound Name | 6,6-dimethylcyclohexa-1,3-diene-1,3-diol |
|---|---|
| PubChem CID | 163590235 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 6,6-dimethylcyclohexa-1,3-diene-1,3-diol |
| SMILES | CC1(C)CC=C(O)C=C1O |
| InChI | InChI=1S/C8H12O2/c1-8(2)4-3-6(9)5-7(8)10/h3,5,9-10H,4H2,1-2H3 |
| InChIKey | GOXPIRWGSKPHJU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |