C15H26O — CID 154169989
6,6-ditert-butyl-3-methylcyclohexa-1,3-dien-1-ol (PubChem CID 154169989) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 6,6-ditert-butyl-3-methylcyclohexa-1,3-dien-1-ol.
| Compound Name | 6,6-ditert-butyl-3-methylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 154169989 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 6,6-ditert-butyl-3-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1=CCC(C(C)(C)C)(C(C)(C)C)C(O)=C1 |
| InChI | InChI=1S/C15H26O/c1-11-8-9-15(12(16)10-11,13(2,3)4)14(5,6)7/h8,10,16H,9H2,1-7H3 |
| InChIKey | FINGTLKXGLZKGN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |