C9H12O3 — CID 131713934
2,6-dihydroxy-1,4-dimethylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 131713934) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2,6-dihydroxy-1,4-dimethylcyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 2,6-dihydroxy-1,4-dimethylcyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 131713934 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2,6-dihydroxy-1,4-dimethylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CC1=CC(O)C(C)(C=O)C(O)=C1 |
| InChI | InChI=1S/C9H12O3/c1-6-3-7(11)9(2,5-10)8(12)4-6/h3-5,7,11-12H,1-2H3 |
| InChIKey | YALDRFTYWVSSGI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|