C12H18O2 — CID 139799810
6-tert-butyl-1-hydroxy-4-methylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 139799810) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 6-tert-butyl-1-hydroxy-4-methylcyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 6-tert-butyl-1-hydroxy-4-methylcyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 139799810 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 6-tert-butyl-1-hydroxy-4-methylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CC1=CC(C(C)(C)C)C(O)(C=O)C=C1 |
| InChI | InChI=1S/C12H18O2/c1-9-5-6-12(14,8-13)10(7-9)11(2,3)4/h5-8,10,14H,1-4H3 |
| InChIKey | HNZPJMSGSVEPOA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|