3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid

C7H8O6 — CID 175149191

IUPAC3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid
SMILESO=C(O)C1=CC(O)C(O)(O)C(O)=C1
InChIInChI=1S/C7H8O6/c8-4-1-3(6(10)11)2-5(9)7(4,12)13/h1-2,4,8-9,12-13H,(H,10,11)
InChIKeyNEFDRSSFAYZJPW-UHFFFAOYSA-N
MW188.13 g/mol
LogP-1.51
Rot. Bonds1

About 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid

3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 175149191) has the molecular formula C7H8O6 and a molecular weight of 188.13 g/mol. Its IUPAC name is 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid.

Molecular Properties

Compound Name3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid
PubChem CID175149191
Molecular FormulaC7H8O6
Molecular Weight188.13 g/mol
Exact Mass188.03
IUPAC Name3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid
SMILESO=C(O)C1=CC(O)C(O)(O)C(O)=C1
InChIInChI=1S/C7H8O6/c8-4-1-3(6(10)11)2-5(9)7(4,12)13/h1-2,4,8-9,12-13H,(H,10,11)
InChIKeyNEFDRSSFAYZJPW-UHFFFAOYSA-N
XLogP-1.51
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.13
LogP ≤ 5-1.51
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid (CID 175149191) is 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid is O=C(O)C1=CC(O)C(O)(O)C(O)=C1.
What is the InChIKey of 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is NEFDRSSFAYZJPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O6/c8-4-1-3(6(10)11)2-5(9)7(4,12)13/h1-2,4,8-9,12-13H,(H,10,11).
What are the key properties of 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid?
3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 188.13 g/mol, XLogP of -1.51, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 175149191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).