C7H8O6 — CID 175149191
3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 175149191) has the molecular formula C7H8O6 and a molecular weight of 188.13 g/mol. Its IUPAC name is 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 175149191 |
| Molecular Formula | C7H8O6 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 3,4,4,5-tetrahydroxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(O)C(O)(O)C(O)=C1 |
| InChI | InChI=1S/C7H8O6/c8-4-1-3(6(10)11)2-5(9)7(4,12)13/h1-2,4,8-9,12-13H,(H,10,11) |
| InChIKey | NEFDRSSFAYZJPW-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|