C8H11BO4 — CID 144886658
4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 144886658) has the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. Its IUPAC name is 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 144886658 |
| Molecular Formula | C8H11BO4 |
| Molecular Weight | 181.98 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1C=C(C(=O)O)C=CC1B(O)O |
| InChI | InChI=1S/C8H11BO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-5,7,12-13H,1H3,(H,10,11) |
| InChIKey | JDPMTAYBYPBNPU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.98 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|