4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid

C8H11BO4 — CID 144886658

IUPAC4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid
SMILESCC1C=C(C(=O)O)C=CC1B(O)O
InChIInChI=1S/C8H11BO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-5,7,12-13H,1H3,(H,10,11)
InChIKeyJDPMTAYBYPBNPU-UHFFFAOYSA-N
MW181.98 g/mol
LogP0.05
Rot. Bonds2

About 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid

4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 144886658) has the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. Its IUPAC name is 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid.

Molecular Properties

Compound Name4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid
PubChem CID144886658
Molecular FormulaC8H11BO4
Molecular Weight181.98 g/mol
Exact Mass182.08
IUPAC Name4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid
SMILESCC1C=C(C(=O)O)C=CC1B(O)O
InChIInChI=1S/C8H11BO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-5,7,12-13H,1H3,(H,10,11)
InChIKeyJDPMTAYBYPBNPU-UHFFFAOYSA-N
XLogP0.05
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.98
LogP ≤ 50.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid (CID 144886658) is 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid is CC1C=C(C(=O)O)C=CC1B(O)O.
What is the InChIKey of 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is JDPMTAYBYPBNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-5,7,12-13H,1H3,(H,10,11).
What are the key properties of 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 181.98 g/mol, XLogP of 0.05, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-borono-3-methylcyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 144886658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).