C10H10O6 — CID 10751803
(3R,4R)-3-(1-carboxyethenoxy)-4-hydroxy(113C)cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 10751803) has the molecular formula C10H10O6 and a molecular weight of 228.17 g/mol. Its IUPAC name is (3R,4R)-3-(1-carboxyethenoxy)-4-hydroxy(113C)cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | (3R,4R)-3-(1-carboxyethenoxy)-4-hydroxy(113C)cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 10751803 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | (3R,4R)-3-(1-carboxyethenoxy)-4-hydroxy(113C)cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | C=C(O[C@@H]1C=[13C]([13C](=O)O)C=C[C@H]1O)C(=O)O |
| InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-8-4-6(10(14)15)2-3-7(8)11/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/t7-,8-/m1/s1/i6+1,10+1 |
| InChIKey | WTFXTQVDAKGDEY-FBDOYRKXSA-N |
| XLogP | -0.09 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|