C10H13NO6 — CID 10660920
(3R,4R,6S)-4-amino-3-(1-carboxyethenoxy)-6-hydroxycyclohexene-1-carboxylic acid (PubChem CID 10660920) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is (3R,4R,6S)-4-amino-3-(1-carboxyethenoxy)-6-hydroxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,6S)-4-amino-3-(1-carboxyethenoxy)-6-hydroxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 10660920 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3R,4R,6S)-4-amino-3-(1-carboxyethenoxy)-6-hydroxycyclohexene-1-carboxylic acid |
| SMILES | C=C(O[C@@H]1C=C(C(=O)O)[C@@H](O)C[C@H]1N)C(=O)O |
| InChI | InChI=1S/C10H13NO6/c1-4(9(13)14)17-8-2-5(10(15)16)7(12)3-6(8)11/h2,6-8,12H,1,3,11H2,(H,13,14)(H,15,16)/t6-,7+,8-/m1/s1 |
| InChIKey | RHPLODWOFJZWEL-GJMOJQLCSA-N |
| XLogP | -0.93 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|