C7H9NO4 — CID 130020941
5-amino-4-hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylic acid (PubChem CID 130020941) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is 5-amino-4-hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylic acid.
| Compound Name | 5-amino-4-hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 130020941 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 5-amino-4-hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylic acid |
| SMILES | NC1C(O)C=C(C(=O)O)C2OC21 |
| InChI | InChI=1S/C7H9NO4/c8-4-3(9)1-2(7(10)11)5-6(4)12-5/h1,3-6,9H,8H2,(H,10,11) |
| InChIKey | PGVPDAOTSVOFRI-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|