C17H24O5 — CID 163001625
2-[(1R,2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoic acid (PubChem CID 163001625) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-[(1R,2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoic acid.
| Compound Name | 2-[(1R,2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163001625 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[(1R,2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@H]1CC[C@H](C)C(CCC(C)=O)=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H24O5/c1-10-5-8-15(12(3)17(20)21)16(22-13(4)19)9-14(10)7-6-11(2)18/h9-10,15-16H,3,5-8H2,1-2,4H3,(H,20,21)/t10-,15+,16+/m0/s1 |
| InChIKey | UFCOGIDNOQLJLV-AMKSKSKJSA-N |
| XLogP | 2.90 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|