C18H26O5 — CID 5315993
methyl 2-[(2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoate (PubChem CID 5315993) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is methyl 2-[(2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 5315993 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl 2-[(2R,5S)-2-acetyloxy-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1CC[C@H](C)C(CCC(C)=O)=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H26O5/c1-11-6-9-16(13(3)18(21)22-5)17(23-14(4)20)10-15(11)8-7-12(2)19/h10-11,16-17H,3,6-9H2,1-2,4-5H3/t11-,16?,17+/m0/s1 |
| InChIKey | LGQRRFSLSUNMQX-BDYFQFQLSA-N |
| XLogP | 2.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|