C15H22O5 — CID 72708602
[(3S,3aR,4S,7S,8aR)-6-(2-hydroxyethyl)-3,7-dimethyl-2-oxo-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-4-yl] acetate (PubChem CID 72708602) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is [(3S,3aR,4S,7S,8aR)-6-(2-hydroxyethyl)-3,7-dimethyl-2-oxo-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-4-yl] acetate.
| Compound Name | [(3S,3aR,4S,7S,8aR)-6-(2-hydroxyethyl)-3,7-dimethyl-2-oxo-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 72708602 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(3S,3aR,4S,7S,8aR)-6-(2-hydroxyethyl)-3,7-dimethyl-2-oxo-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(CCO)[C@@H](C)C[C@H]2OC(=O)[C@@H](C)[C@@H]12 |
| InChI | InChI=1S/C15H22O5/c1-8-6-12-14(9(2)15(18)20-12)13(19-10(3)17)7-11(8)4-5-16/h7-9,12-14,16H,4-6H2,1-3H3/t8-,9-,12+,13-,14+/m0/s1 |
| InChIKey | RYPWQIGVZVKJLS-OOUKEXCNSA-N |
| XLogP | 1.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|