C19H28O6 — CID 101257668
(1S,3R,5R,7S,8E,10S,11R,13S,14S,15S)-3,5,7,14-tetrahydroxy-13-methyltricyclo[8.7.0.011,15]heptadeca-8,16-diene-8-carboxylic acid (PubChem CID 101257668) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (1S,3R,5R,7S,8E,10S,11R,13S,14S,15S)-3,5,7,14-tetrahydroxy-13-methyltricyclo[8.7.0.011,15]heptadeca-8,16-diene-8-carboxylic acid.
| Compound Name | (1S,3R,5R,7S,8E,10S,11R,13S,14S,15S)-3,5,7,14-tetrahydroxy-13-methyltricyclo[8.7.0.011,15]heptadeca-8,16-diene-8-carboxylic acid |
|---|---|
| PubChem CID | 101257668 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (1S,3R,5R,7S,8E,10S,11R,13S,14S,15S)-3,5,7,14-tetrahydroxy-13-methyltricyclo[8.7.0.011,15]heptadeca-8,16-diene-8-carboxylic acid |
| SMILES | C[C@H]1C[C@H]2[C@H](C=C[C@@H]3C[C@@H](O)C[C@@H](O)C[C@H](O)/C(C(=O)O)=C\[C@H]23)[C@H]1O |
| InChI | InChI=1S/C19H28O6/c1-9-4-15-13(18(9)23)3-2-10-5-11(20)6-12(21)7-17(22)16(19(24)25)8-14(10)15/h2-3,8-15,17-18,20-23H,4-7H2,1H3,(H,24,25)/b16-8+/t9-,10+,11+,12+,13-,14-,15-,17-,18-/m0/s1 |
| InChIKey | LEDCPZPUFNQLFR-FZRSQXMDSA-N |
| XLogP | 0.70 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|