C23H30O6 — CID 10621141
[(1Z,3R,4S,6R,7R,8R,11R,13S,15S)-13-hydroxy-6-methyl-17,18-dioxo-16-oxatetracyclo[13.2.2.03,11.04,8]nonadeca-1,9-dien-7-yl] 2-methylpropanoate (PubChem CID 10621141) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is [(1Z,3R,4S,6R,7R,8R,11R,13S,15S)-13-hydroxy-6-methyl-17,18-dioxo-16-oxatetracyclo[13.2.2.03,11.04,8]nonadeca-1,9-dien-7-yl] 2-methylpropanoate.
| Compound Name | [(1Z,3R,4S,6R,7R,8R,11R,13S,15S)-13-hydroxy-6-methyl-17,18-dioxo-16-oxatetracyclo[13.2.2.03,11.04,8]nonadeca-1,9-dien-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 10621141 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [(1Z,3R,4S,6R,7R,8R,11R,13S,15S)-13-hydroxy-6-methyl-17,18-dioxo-16-oxatetracyclo[13.2.2.03,11.04,8]nonadeca-1,9-dien-7-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@@H]2C=C[C@H]3C[C@H](O)C[C@H]4CC(=O)/C(=C\[C@H]3[C@@H]2C[C@H]1C)C(=O)O4 |
| InChI | InChI=1S/C23H30O6/c1-11(2)22(26)29-21-12(3)6-18-16(21)5-4-13-7-14(24)8-15-9-20(25)19(10-17(13)18)23(27)28-15/h4-5,10-18,21,24H,6-9H2,1-3H3/b19-10-/t12-,13+,14+,15+,16-,17-,18-,21-/m1/s1 |
| InChIKey | MZJTYQKDPUVKJE-UBAWGLRTSA-N |
| XLogP | 2.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|