About 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid
6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 163928155) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid.
Analyze 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid (CID 163928155) is 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid is CC1=CCC(C)(N)C(C(=O)O)=C1.
What is the InChIKey of 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is RGHXMOCXJXQNQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-6-3-4-9(2,10)7(5-6)8(11)12/h3,5H,4,10H2,1-2H3,(H,11,12).
What are the key properties of 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid?
6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 167.21 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,6-dimethylcyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 163928155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).