C10H14O3 — CID 10773768
1-hydroxy-4-methylbicyclo[2.2.2]oct-2-ene-2-carboxylic acid (PubChem CID 10773768) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-hydroxy-4-methylbicyclo[2.2.2]oct-2-ene-2-carboxylic acid.
| Compound Name | 1-hydroxy-4-methylbicyclo[2.2.2]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10773768 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-hydroxy-4-methylbicyclo[2.2.2]oct-2-ene-2-carboxylic acid |
| SMILES | CC12C=C(C(=O)O)C(O)(CC1)CC2 |
| InChI | InChI=1S/C10H14O3/c1-9-2-4-10(13,5-3-9)7(6-9)8(11)12/h6,13H,2-5H2,1H3,(H,11,12) |
| InChIKey | IMTWZLHCQVCWFN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |