C6H4O6 — CID 155748104
cycloprop-2-ene-1,1,2-tricarboxylic acid (PubChem CID 155748104) has the molecular formula C6H4O6 and a molecular weight of 172.09 g/mol. Its IUPAC name is cycloprop-2-ene-1,1,2-tricarboxylic acid.
| Compound Name | cycloprop-2-ene-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 155748104 |
| Molecular Formula | C6H4O6 |
| Molecular Weight | 172.09 g/mol |
| Exact Mass | 172.00 |
| IUPAC Name | cycloprop-2-ene-1,1,2-tricarboxylic acid |
| SMILES | O=C(O)C1=CC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H4O6/c7-3(8)2-1-6(2,4(9)10)5(11)12/h1H,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | BOYPCDZNVGHJKC-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.09 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|