C12H14O5 — CID 117348722
5-(1-hydroxycyclopropyl)-2,4-dimethoxybenzoic acid (PubChem CID 117348722) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 5-(1-hydroxycyclopropyl)-2,4-dimethoxybenzoic acid.
| Compound Name | 5-(1-hydroxycyclopropyl)-2,4-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 117348722 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 5-(1-hydroxycyclopropyl)-2,4-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(C2(O)CC2)cc1C(=O)O |
| InChI | InChI=1S/C12H14O5/c1-16-9-6-10(17-2)8(12(15)3-4-12)5-7(9)11(13)14/h5-6,15H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | ADPJZMDUKFBQNZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |