C10H10O4 — CID 123625122
4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylic acid (PubChem CID 123625122) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylic acid.
| Compound Name | 4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 123625122 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylic acid |
| SMILES | CC1=CCC=C(C(=O)O)C(C(=O)O)=C1 |
| InChI | InChI=1S/C10H10O4/c1-6-3-2-4-7(9(11)12)8(5-6)10(13)14/h3-5H,2H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | NWHXPMDUHGHRFE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |