C9H12O2 — CID 123404809
3,6-dimethylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 123404809) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 3,6-dimethylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 3,6-dimethylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 123404809 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 3,6-dimethylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1=CCC(C)C=C1C(=O)O |
| InChI | InChI=1S/C9H12O2/c1-6-3-4-7(2)8(5-6)9(10)11/h4-6H,3H2,1-2H3,(H,10,11) |
| InChIKey | DPPBXHSCWIQFAI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |