C14H28 — CID 142036504
ethane;3-ethyl-2,5-dimethylcyclohexa-1,3-diene (PubChem CID 142036504) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is ethane;3-ethyl-2,5-dimethylcyclohexa-1,3-diene.
| Compound Name | ethane;3-ethyl-2,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142036504 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | ethane;3-ethyl-2,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC.CC.CCC1=CC(C)CC=C1C |
| InChI | InChI=1S/C10H16.2C2H6/c1-4-10-7-8(2)5-6-9(10)3;2*1-2/h6-8H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | VWVOJUYHBJRWSZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |