C15H26O — CID 70837510
4-(6-butyl-3-methylcyclohexa-1,5-dien-1-yl)butan-2-ol (PubChem CID 70837510) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 4-(6-butyl-3-methylcyclohexa-1,5-dien-1-yl)butan-2-ol.
| Compound Name | 4-(6-butyl-3-methylcyclohexa-1,5-dien-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 70837510 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 4-(6-butyl-3-methylcyclohexa-1,5-dien-1-yl)butan-2-ol |
| SMILES | CCCCC1=CCC(C)C=C1CCC(C)O |
| InChI | InChI=1S/C15H26O/c1-4-5-6-14-9-7-12(2)11-15(14)10-8-13(3)16/h9,11-13,16H,4-8,10H2,1-3H3 |
| InChIKey | QZDNVZXAAWYJRN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |