C8H10BrN — CID 170108403
7-bromo-3-methylcyclohepta-1,3,6-trien-1-amine (PubChem CID 170108403) has the molecular formula C8H10BrN and a molecular weight of 200.08 g/mol. Its IUPAC name is 7-bromo-3-methylcyclohepta-1,3,6-trien-1-amine.
| Compound Name | 7-bromo-3-methylcyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 170108403 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 7-bromo-3-methylcyclohepta-1,3,6-trien-1-amine |
| SMILES | CC1=CCC=C(Br)C(N)=C1 |
| InChI | InChI=1S/C8H10BrN/c1-6-3-2-4-7(9)8(10)5-6/h3-5H,2,10H2,1H3 |
| InChIKey | UPSNNGCMPUUASS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |