C6H4ClFN2O4 — CID 174393579
5-chloro-5-fluoro-6,6-dinitrocyclohexa-1,3-diene (PubChem CID 174393579) has the molecular formula C6H4ClFN2O4 and a molecular weight of 222.56 g/mol. Its IUPAC name is 5-chloro-5-fluoro-6,6-dinitrocyclohexa-1,3-diene.
| Compound Name | 5-chloro-5-fluoro-6,6-dinitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174393579 |
| Molecular Formula | C6H4ClFN2O4 |
| Molecular Weight | 222.56 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 5-chloro-5-fluoro-6,6-dinitrocyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1([N+](=O)[O-])C=CC=CC1(F)Cl |
| InChI | InChI=1S/C6H4ClFN2O4/c7-5(8)3-1-2-4-6(5,9(11)12)10(13)14/h1-4H |
| InChIKey | WUUIXEIEXSMNMD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|