About (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol
(1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol (PubChem CID 174717778) has the molecular formula C7H8N2O6
and a molecular weight of 216.15 g/mol. Its IUPAC name is (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol.
Molecular Properties
| Compound Name | (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol |
| PubChem CID | 174717778 |
| Molecular Formula | C7H8N2O6 |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol |
| SMILES | O=[N+]([O-])C1C=CC=CC1(C(O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N2O6/c10-6(11)7(9(14)15)4-2-1-3-5(7)8(12)13/h1-6,10-11H |
| InChIKey | NAXHDRLQURBEGR-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol?
The IUPAC name of (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol (CID 174717778) is (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol.
What is the SMILES notation for (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol?
The canonical SMILES for (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol is O=[N+]([O-])C1C=CC=CC1(C(O)O)[N+](=O)[O-].
What is the InChIKey of (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol?
The InChIKey is NAXHDRLQURBEGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O6/c10-6(11)7(9(14)15)4-2-1-3-5(7)8(12)13/h1-6,10-11H.
What are the key properties of (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol?
(1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol has a molecular weight of 216.15 g/mol, XLogP of -0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dinitrocyclohexa-2,4-dien-1-yl)methanediol is sourced from PubChem (CID 174717778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).